139126-45-7 Usage
Description
1-(Aminomethyl)cyclopropanecarboxylic acid, with the molecular formula C5H9NO2, is an amino acid derivative featuring a cyclopropane ring. It is a versatile chemical compound that serves as a building block in medicinal chemistry, with potential applications in the synthesis of pharmaceuticals and agrochemicals. Its unique structure and properties have attracted interest for use in designing new drugs and as a precursor in the synthesis of amino acid derivatives, which are crucial for the development of novel chemicals and materials. Furthermore, it has been studied for its pharmacological activities, including its effects on neurotransmitter systems and its potential as a drug target for various medical conditions.
Uses
Used in Pharmaceutical Industry:
1-(Aminomethyl)cyclopropanecarboxylic acid is used as a building block in the synthesis of pharmaceuticals for its potential to contribute to the development of new drugs. Its unique cyclopropane ring and amino acid derivative nature allow for the creation of innovative molecular structures with potential therapeutic benefits.
Used in Agrochemical Industry:
In the agrochemical industry, 1-(Aminomethyl)cyclopropanecarboxylic acid is utilized as a precursor in the synthesis of agrochemicals, contributing to the development of new pesticides or other agricultural chemicals that can improve crop protection and yield.
Used in Medicinal Chemistry Research:
1-(Aminomethyl)cyclopropanecarboxylic acid is employed as a research compound in medicinal chemistry, where it is studied for its potential to influence neurotransmitter systems. This research aims to understand its interactions with biological targets, which could lead to the discovery of new drug candidates for various medical conditions.
Used in Chemical and Material Development:
As a precursor in the synthesis of amino acid derivatives, 1-(Aminomethyl)cyclopropanecarboxylic acid is used in the development of new chemicals and materials. Its cyclopropane ring provides a unique structural element that can be leveraged to create novel compounds with specific properties for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 139126-45-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,9,1,2 and 6 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 139126-45:
(8*1)+(7*3)+(6*9)+(5*1)+(4*2)+(3*6)+(2*4)+(1*5)=127
127 % 10 = 7
So 139126-45-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H9NO2/c6-3-5(1-2-5)4(7)8/h1-3,6H2,(H,7,8)
139126-45-7Relevant articles and documents
Pharmaceutical compounds
-
, (2008/06/13)
The invention provides novel cryptophycin compounds which can be useful for disrupting the microtubulin system, as antineoplastic agents, antifungal, and for the treatment of cancer. The invention further provides a formulation for administering the novel cryptophycin compounds.
