139256-79-4 Usage
Description
1-Cyclopropylpiperazine dihydrochloride, a derivative of piperazine, is a chemical compound with two hydrochloride groups attached to the cyclopropylpiperazine molecule. This addition enhances its stability and water solubility, making it a versatile intermediate in the synthesis of pharmaceutical compounds. Its unique chemical properties lend it potential applications in both medicinal and research fields.
Uses
Used in Pharmaceutical Industry:
1-Cyclopropylpiperazine dihydrochloride is used as an intermediate in the synthesis of various medications and drugs, contributing to the development of new pharmaceuticals with improved efficacy and safety profiles.
Used in Research and Development:
1-Cyclopropylpiperazine dihydrochloride serves as a research chemical, facilitating the exploration of new pharmaceutical compounds and advancing scientific understanding in medicinal chemistry. Its unique properties make it a valuable tool for studying drug interactions and mechanisms of action.
Check Digit Verification of cas no
The CAS Registry Mumber 139256-79-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,9,2,5 and 6 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 139256-79:
(8*1)+(7*3)+(6*9)+(5*2)+(4*5)+(3*6)+(2*7)+(1*9)=154
154 % 10 = 4
So 139256-79-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H14N2.2ClH/c1-2-7(1)9-5-3-8-4-6-9;;/h7-8H,1-6H2;2*1H
