139446-71-2 Usage
Description
Ranakinin is a neuropeptide found in various insects such as bees, ants, and fruit flies. It plays a crucial role in the regulation of physiological processes, including feeding behavior, social behavior, and stress responses. As a neuromodulator in the insect nervous system, ranakinin influences the release of neurotransmitters and hormones. Its study is significant for understanding insect neurobiology and has potential applications in pest control, pharmaceutical development, and biopesticide creation.
Uses
Used in Insect Pest Control:
Ranakinin is used as a potential agent for insect pest control due to its involvement in the regulation of physiological processes in insects. By targeting specific behaviors or responses, it may offer a novel approach to managing insect pests.
Used in Pharmaceutical Development:
Ranakinin is used as a subject of research for the development of new pharmaceuticals. Its role in the insect nervous system and its influence on neurotransmitter and hormone release make it a promising candidate for the creation of drugs that could potentially mimic or inhibit its effects for various therapeutic purposes.
Used in Biopesticide Development:
Ranakinin is used as a basis for the development of biopesticides. Its potential role in insect behavior and stress responses could be harnessed to create environmentally friendly pest control solutions that target specific insect species without harming non-target organisms.
Used in Neurobiological Research:
Ranakinin is used as a key chemical in the study of insect neurobiology. Understanding its functions and mechanisms can provide insights into the molecular basis of social behavior, feeding habits, and stress responses in insects, which could have broader implications for the fields of entomology and neuroscience.
Check Digit Verification of cas no
The CAS Registry Mumber 139446-71-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,9,4,4 and 6 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 139446-71:
(8*1)+(7*3)+(6*9)+(5*4)+(4*4)+(3*6)+(2*7)+(1*1)=152
152 % 10 = 2
So 139446-71-2 is a valid CAS Registry Number.
InChI:InChI=1/C62H95N17O15S/c1-35(2)30-43(56(89)72-40(52(66)85)24-29-95-3)71-50(82)34-70-53(86)44(32-37-18-20-38(80)21-19-37)75-57(90)45(31-36-12-5-4-6-13-36)76-54(87)41(15-9-26-69-62(67)68)73-55(88)42(22-23-51(83)84)74-58(91)48-17-11-28-79(48)61(94)46(33-49(65)81)77-59(92)47-16-10-27-78(47)60(93)39(64)14-7-8-25-63/h4-6,12-13,18-21,35,39-48,80H,7-11,14-17,22-34,63-64H2,1-3H3,(H2,65,81)(H2,66,85)(H,70,86)(H,71,82)(H,72,89)(H,73,88)(H,74,91)(H,75,90)(H,76,87)(H,77,92)(H,83,84)(H4,67,68,69)/t39-,40-,41-,42-,43-,44-,45-,46-,47-,48?/m0/s1