139539-63-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Cyano-4,6-dimethoxy-pyrimidine serves as a crucial precursor in the manufacturing of various drugs and agrochemicals. Its unique structure allows for the development of new therapeutic agents and contributes to the advancement of medicinal chemistry.
Used in Industrial Processes:
In the industrial sector, 2-Cyano-4,6-dimethoxy-pyrimidine is utilized as a key component in the synthesis of complex organic molecules. Its versatility in chemical reactions makes it valuable for creating a wide range of products.
Used in Medicinal Chemistry Research:
2-Cyano-4,6-dimethoxy-pyrimidine is studied for its potential biological activities, such as antifungal and anticancer properties. This research is vital for discovering new treatments and therapeutic approaches in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 139539-63-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,9,5,3 and 9 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 139539-63:
(8*1)+(7*3)+(6*9)+(5*5)+(4*3)+(3*9)+(2*6)+(1*3)=162
162 % 10 = 2
So 139539-63-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3O2/c1-11-6-3-7(12-2)10-5(4-8)9-6/h3H,1-2H3
