139719-24-7 Usage
General Description
2-Chloro-4,6,8-trimethyl-quinoline, also known as CTMQ, is a heterocyclic compound with a quinoline backbone and a chlorine atom attached to the 2-position. It is a yellowish-brown liquid with a molecular formula C12H12ClN. CTMQ is commonly used as an intermediate in the synthesis of pharmaceuticals, dyes, and other organic compounds. It is also known for its antimicrobial and anticancer properties, making it a potential candidate for drug development. Additionally, CTMQ has been studied for its potential use as an insecticide and a corrosion inhibitor. However, further research is needed to fully understand its potential applications and to determine its safety and environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 139719-24-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,9,7,1 and 9 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 139719-24:
(8*1)+(7*3)+(6*9)+(5*7)+(4*1)+(3*9)+(2*2)+(1*4)=157
157 % 10 = 7
So 139719-24-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H12ClN/c1-7-4-9(3)12-10(5-7)8(2)6-11(13)14-12/h4-6H,1-3H3
