139975-78-3 Usage
Uses
Used in Pharmaceutical Development:
3-(5-BROMO-2-METHYL-4-NITRO-1H-IMIDAZOL-1-YL)PROPANENITRILE is used as a precursor in the synthesis of pharmaceuticals for its potential to exhibit antifungal and antibacterial properties. Its unique structure allows it to be a candidate for the development of new drugs targeting various microbial infections.
Used in Research:
In the scientific community, 3-(5-BROMO-2-METHYL-4-NITRO-1H-IMIDAZOL-1-YL)PROPANENITRILE is used as a research compound to explore its chemical and biological properties. This includes investigating its reactivity, stability, and interactions with biological systems, which can provide insights into its potential therapeutic applications.
Used in Chemical Synthesis:
3-(5-BROMO-2-METHYL-4-NITRO-1H-IMIDAZOL-1-YL)PROPANENITRILE is utilized as an intermediate in chemical synthesis processes, particularly for the creation of complex organic molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Used in Antimicrobial Applications:
3-(5-BROMO-2-METHYL-4-NITRO-1H-IMIDAZOL-1-YL)PROPANENITRILE is employed as an antimicrobial agent, particularly for its potential to combat fungal and bacterial infections. Its specific chemical structure may contribute to its effectiveness in inhibiting the growth of various pathogenic organisms.
The precise properties and applications of 3-(5-BROMO-2-METHYL-4-NITRO-1H-IMIDAZOL-1-YL)PROPANENITRILE are subject to ongoing investigation and experimentation, as the scientific community continues to explore its full potential in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 139975-78-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,9,9,7 and 5 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 139975-78:
(8*1)+(7*3)+(6*9)+(5*9)+(4*7)+(3*5)+(2*7)+(1*8)=193
193 % 10 = 3
So 139975-78-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H7BrN4O2/c1-5-10-7(12(13)14)6(8)11(5)4-2-3-9/h2,4H2,1H3
Xn:Harmful;
