14015-63-5 Usage
Uses
Used in Pharmaceutical Industry:
[4-(p-Nitrophenyl)-2-thiazolyl]thiourea is used as an intermediate in the synthesis of pharmaceutical drugs for its ability to contribute to the development of new therapeutic agents. Its unique structure allows it to be a key component in creating medications with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, [4-(p-Nitrophenyl)-2-thiazolyl]thiourea is used as an intermediate in the synthesis of agrochemicals, where its chemical properties can be leveraged to develop compounds that address various agricultural needs.
Used in Dye Industry:
[4-(p-Nitrophenyl)-2-thiazolyl]thiourea is utilized as an intermediate in the synthesis of dyes, capitalizing on its chemical structure to create dyes with specific color characteristics and properties.
Used in Anti-tumor Applications:
[4-(p-Nitrophenyl)-2-thiazolyl]thiourea is used as a potential anti-tumor agent due to its exhibited anti-tumor activities, making it a candidate for the development of new cancer treatments.
Used in Anti-inflammatory Applications:
[4-(p-Nitrophenyl)-2-thiazolyl]thiourea is also used as an anti-inflammatory agent, leveraging its anti-inflammatory properties for the development of therapeutics aimed at reducing inflammation.
Used in Material Development:
[4-(p-Nitrophenyl)-2-thiazolyl]thiourea may have uses in the development of materials, where its unique chemical structure and properties can be employed to create new materials with specific characteristics.
Used in Organic Synthesis:
In the field of organic synthesis, [4-(p-Nitrophenyl)-2-thiazolyl]thiourea is used as a versatile building block, contributing to the creation of a wide range of organic compounds for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 14015-63-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,0,1 and 5 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14015-63:
(7*1)+(6*4)+(5*0)+(4*1)+(3*5)+(2*6)+(1*3)=65
65 % 10 = 5
So 14015-63-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N4O2S2/c11-9(17)13-10-12-8(5-18-10)6-1-3-7(4-2-6)14(15)16/h1-5H,(H3,11,12,13,17)
