14015-63-5 Usage
General Description
[4-(p-Nitrophenyl)-2-thiazolyl]thiourea is a chemical compound with the molecular formula C9H7N3O2S. It is a thiourea derivative that contains a thiazole ring and a nitrophenyl group. [4-(p-Nitrophenyl)-2-thiazolyl]thiourea can be used in various biological and pharmaceutical applications, including as an intermediate in the synthesis of pharmaceutical drugs, agrochemicals, and dyes. It also exhibits anti-tumor and anti-inflammatory activities, making it a potential candidate for the development of new therapeutic agents. Additionally, [4-(p-Nitrophenyl)-2-thiazolyl]thiourea may have uses in the development of materials and in organic synthesis due to its unique chemical structure and properties. Overall, this compound has potential applications in various fields and continues to be of interest to researchers for its diverse properties.
Check Digit Verification of cas no
The CAS Registry Mumber 14015-63-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,0,1 and 5 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14015-63:
(7*1)+(6*4)+(5*0)+(4*1)+(3*5)+(2*6)+(1*3)=65
65 % 10 = 5
So 14015-63-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N4O2S2/c11-9(17)13-10-12-8(5-18-10)6-1-3-7(4-2-6)14(15)16/h1-5H,(H3,11,12,13,17)
