1402-10-4 Usage
General Description
Lichenin, also known as lichenan or moss starch, is a complex sugar or polysaccharide commonly found in certain types of lichens and red algae. It is a type of beta-glucan with glucose units linked by β-1,3 and β-1,4 bonds, similar to the structure of cellulose. The presence of this linkage gives lichenin its unique features, such as being non-digestible and largely insoluble in water. It possesses potential health benefits due to its prebiotic properties and ability to modulate the immune system. Nevertheless, extensive research is still needed to fully understand the potential applications and benefits of lichenin.
Check Digit Verification of cas no
The CAS Registry Mumber 1402-10-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,4,0 and 2 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1402-10:
(6*1)+(5*4)+(4*0)+(3*2)+(2*1)+(1*0)=34
34 % 10 = 4
So 1402-10-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H10O5/c7-1-4-6(10)5(9)3(8)2-11-4/h2,4-10H,1H2/t4-,5-,6-/m0/s1
