140640-93-3 Usage
Molecular Structure
The compound has a fused pyridine and pyrrolo ring system, with a carboxaldehyde group at the 5 position of the pyrrolo ring and a 4-(4-fluorophenyl)-6-(1-methylethyl) substituent attached to the core structure.
Functional Groups
The main functional groups present in the compound are a carboxaldehyde group and a fluorophenyl group, which contribute to its reactivity and potential applications in various fields.
Aromaticity
The compound exhibits aromaticity due to the presence of the pyridine and pyrrolo rings, which are known for their stable and planar structures.
Fluorine Substitution
The presence of a fluorine atom on the phenyl ring can influence the compound's reactivity, polarity, and lipophilicity, making it a potentially important factor in its applications.
Methyl Substitution
The 1-methylethyl (isopropyl) group attached to the 6 position of the compound can affect its steric properties and solubility, which may be relevant for its applications in various fields.
Potential Applications
Due to its unique structure and functional groups, the compound may have potential applications in pharmaceuticals, agrochemicals, or materials science. It may also be useful as a building block for the synthesis of other organic compounds.
Stability
The compound's stability may be influenced by the presence of the carboxaldehyde group, which can be sensitive to oxidation and other reactions. However, the aromaticity of the pyridine and pyrrolo rings provides a stable core structure.
Synthesis
The synthesis of this compound may involve the formation of the pyrrolo-pyridine core structure, followed by the introduction of the carboxaldehyde group and the 4-(4-fluorophenyl)-6-(1-methylethyl) substituent through various chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 140640-93-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,0,6,4 and 0 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 140640-93:
(8*1)+(7*4)+(6*0)+(5*6)+(4*4)+(3*0)+(2*9)+(1*3)=103
103 % 10 = 3
So 140640-93-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H15FN2O/c1-10(2)16-14(9-21)15(11-3-5-12(18)6-4-11)13-7-8-19-17(13)20-16/h3-10H,1-2H3,(H,19,20)