14068-40-7 Usage
General Description
5-(2-diethylamino-ethyl)-[1,3,4]thiadiazol-2-ylamine is a chemical compound with the molecular formula C10H18N4S. It is a thiadiazole derivative with a substituent of diethylaminoethyl group. Thiadiazole compounds have been found to possess various biological activities, such as antimicrobial, anticancer, and antifungal properties. This specific compound may have potential applications in the pharmaceutical industry for the development of new drugs. Its precise biological and chemical properties are the subject of ongoing research, and further studies are needed to fully understand its potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 14068-40-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,0,6 and 8 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 14068-40:
(7*1)+(6*4)+(5*0)+(4*6)+(3*8)+(2*4)+(1*0)=87
87 % 10 = 7
So 14068-40-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H16N4S/c1-3-12(4-2)6-5-7-10-11-8(9)13-7/h3-6H2,1-2H3,(H2,9,11)