14080-58-1 Usage
General Description
4-Hydrazinothieno[2,3-d]pyrimidine is a chemical compound with the molecular formula C6H5N5S. It is a heterocyclic compound containing a thieno[2,3-d]pyrimidine ring system, which makes it useful in pharmaceutical and chemical research. 4-Hydrazinothieno[2,3-d]pyrimidine is known for its potential as an antitumor agent and has been studied for its inhibitory effects on certain enzymes and biological pathways. Its unique structure and potential pharmacological activities make 4-Hydrazinothieno[2,3-d]pyrimidine an important compound in medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 14080-58-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,0,8 and 0 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 14080-58:
(7*1)+(6*4)+(5*0)+(4*8)+(3*0)+(2*5)+(1*8)=81
81 % 10 = 1
So 14080-58-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4S/c7-10-5-4-1-2-11-6(4)9-3-8-5/h1-3H,7H2,(H,8,9,10)