14080-58-1 Usage
Uses
Used in Pharmaceutical Research:
4-Hydrazinothieno[2,3-d]pyrimidine is used as a research compound for its potential antitumor properties. It is studied for its inhibitory effects on certain enzymes and biological pathways that are implicated in the development and progression of cancer.
Used in Drug Development:
In the field of drug development, 4-Hydrazinothieno[2,3-d]pyrimidine is utilized as a lead compound for the design and synthesis of new therapeutic agents. Its unique structure provides a foundation for the creation of novel drugs that could target specific cancer-related pathways, offering potential benefits in the treatment of various malignancies.
Used in Chemical Research:
4-Hydrazinothieno[2,3-d]pyrimidine is also used in chemical research to explore its reactivity and potential to form new compounds with therapeutic or other useful properties. Its heterocyclic nature allows for a wide range of chemical modifications, which can lead to the discovery of new chemical entities with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 14080-58-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,0,8 and 0 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 14080-58:
(7*1)+(6*4)+(5*0)+(4*8)+(3*0)+(2*5)+(1*8)=81
81 % 10 = 1
So 14080-58-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4S/c7-10-5-4-1-2-11-6(4)9-3-8-5/h1-3H,7H2,(H,8,9,10)
Harmful:;
