14091-12-4 Usage
Uses
Used in Biochemistry Research:
3-CHLORO-DL-PHENYLALANINE is used as a research compound for studying protein structure and function. Its increased reactivity compared to phenylalanine allows for a better understanding of the interactions and mechanisms within proteins.
Used in Protein Sequencing and Synthesis:
3-CHLORO-DL-PHENYLALANINE is used as a reagent in protein sequencing and synthesis processes. Its unique properties enable researchers to identify and analyze specific amino acid sequences within proteins, contributing to the development of new therapeutic strategies and diagnostic tools.
Used in Controlled Laboratory Settings:
3-CHLORO-DL-PHENYLALANINE is used as a controlled substance in laboratory experiments. Due to its potential toxicity and neurotoxic effects, it is essential to handle 3-CHLORO-DL-PHENYLALANINE with caution and within a controlled environment to ensure safety and prevent adverse effects.
Check Digit Verification of cas no
The CAS Registry Mumber 14091-12-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,0,9 and 1 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 14091-12:
(7*1)+(6*4)+(5*0)+(4*9)+(3*1)+(2*1)+(1*2)=74
74 % 10 = 4
So 14091-12-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H10ClNO2/c10-7(8(11)9(12)13)6-4-2-1-3-5-6/h1-5,7-8H,11H2,(H,12,13)/t7?,8-/m0/s1
