140924-50-1 Usage
Description
(DHQ)2PHAL, also known as dihydroquinine-phthalazine, is a modified cinchona alkaloid derived from the natural compound found in the bark of the cinchona tree. It is a chiral catalyst that plays a crucial role in various chemical reactions, particularly in the field of asymmetric synthesis. Its unique structure allows it to selectively promote specific reactions, making it a valuable tool in organic chemistry.
Uses
Used in Asymmetric Synthesis:
(DHQ)2PHAL is used as a chiral catalyst for the asymmetric chlorinative dearomatization reaction of benzofuran derivatives. This reaction is essential in the synthesis of complex organic molecules, including pharmaceuticals and natural products. The catalyst's ability to selectively promote this reaction contributes to the development of enantiomerically pure compounds, which are crucial in the pharmaceutical industry due to their potential for improved efficacy and reduced side effects.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, (DHQ)2PHAL is used as a key intermediate in the synthesis of various chiral drugs. Its ability to selectively promote specific reactions allows for the production of enantiomerically pure compounds, which are essential for the development of effective and safe medications. The use of (DHQ)2PHAL in this context helps to improve the overall efficiency and selectivity of the drug synthesis process, ultimately leading to better therapeutic outcomes for patients.
Used in Chemical Research:
(DHQ)2PHAL is also used as a research tool in the field of organic chemistry. Its unique catalytic properties make it an invaluable asset for studying various reaction mechanisms and exploring new synthetic pathways. Researchers can use (DHQ)2PHAL to investigate the role of chirality in chemical reactions and develop a deeper understanding of the factors that influence reaction selectivity. This knowledge can then be applied to the design of new catalysts and the optimization of existing synthetic processes.
Check Digit Verification of cas no
The CAS Registry Mumber 140924-50-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,0,9,2 and 4 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 140924-50:
(8*1)+(7*4)+(6*0)+(5*9)+(4*2)+(3*4)+(2*5)+(1*0)=111
111 % 10 = 1
So 140924-50-1 is a valid CAS Registry Number.
InChI:InChI=1/C48H54N6O4/c1-5-29-27-53-21-17-31(29)23-43(53)45(35-15-19-49-41-13-11-33(55-3)25-39(35)41)57-47-37-9-7-8-10-38(37)48(52-51-47)58-46(44-24-32-18-22-54(44)28-30(32)6-2)36-16-20-50-42-14-12-34(56-4)26-40(36)42/h7-16,19-20,25-26,29-32,43-46H,5-6,17-18,21-24,27-28H2,1-4H3/t29-,30-,31-,32-,43-,44-,45+,46+/m0/s1
140924-50-1Relevant articles and documents
The Osmium-Catalyzed Asymmetric Dihydroxylation: A New Ligand Class and a Process Improvement
Sharpless, K. Barry,Amberg, Willi,Bennani, Youssef L.,Crispino, Gerard A.,Hartung, Jens,et al.
, p. 2768 - 2771 (2007/10/02)
Two key improvements in the osmium-catalyzed asymmetric dihydroxylation have led to a simple procedure which is applicable to a wide range of olefins.