141034-42-6 Usage
General Description
DAT 582 is a complex chemical compound containing a mixture of didecyl dimethyl ammonium chloride, alkyl dimethyl benzyl ammonium chloride, and other quaternary ammonium compounds. It is commonly used as a disinfectant and sanitizer in various industrial and household applications, such as in hospitals, schools, and food processing facilities. DAT 582 exhibits broad-spectrum antimicrobial activity against bacteria, viruses, and fungi, making it effective in controlling the spread of infectious diseases. It works by disrupting the cell membranes of microorganisms, leading to their inactivation and death. Additionally, DAT 582 is known for its stability and long-lasting residual effects, providing prolonged protection against pathogens. Despite its potency, safety precautions and proper handling are necessary when using DAT 582 due to its potential irritant and toxic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 141034-42-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,1,0,3 and 4 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 141034-42:
(8*1)+(7*4)+(6*1)+(5*0)+(4*3)+(3*4)+(2*4)+(1*2)=76
76 % 10 = 6
So 141034-42-6 is a valid CAS Registry Number.
InChI:InChI=1/C22H27N5O.2ClH/c1-16-6-5-7-17(12-16)13-27-11-10-26(2)14-18(15-27)23-22(28)21-19-8-3-4-9-20(19)24-25-21;;/h3-9,12,18H,10-11,13-15H2,1-2H3,(H,23,28)(H,24,25);2*1H/t18-;;/m1../s1