141269-99-0 Usage
Description
(S)-4-[2-HYDROXY-3-PHENOXYPROPYLAMINOETHOXY]PHENOXYACETIC ACID HYDROCHLORIDE is a complex organic compound with a chemical structure that features a phenoxyacetic acid backbone, hydroxy and phenoxypropylaminoethoxy groups, and a hydrochloride salt form. (S)-4-[2-HYDROXY-3-PHENOXYPROPYLAMINOETHOXY]PHENOXYACETIC ACID HYDROCHLORIDE is characterized by its unique arrangement of functional groups, which may contribute to its potential applications in various fields.
Uses
Used in Pharmaceutical Research:
(S)-4-[2-HYDROXY-3-PHENOXYPROPYLAMINOETHOXY]PHENOXYACETIC ACID HYDROCHLORIDE is used as a research compound for studying its potential pharmacological properties and applications in the development of new drugs. Its unique chemical structure may provide insights into the design of novel therapeutic agents.
Used in Chemical Synthesis:
In the chemical industry, (S)-4-[2-HYDROXY-3-PHENOXYPROPYLAMINOETHOXY]PHENOXYACETIC ACID HYDROCHLORIDE can be used as a starting material or intermediate in the synthesis of more complex molecules with specific applications, such as pharmaceuticals, agrochemicals, or other specialty chemicals.
Used in Analytical Chemistry:
(S)-4-[2-HYDROXY-3-PHENOXYPROPYLAMINOETHOXY]PHENOXYACETIC ACID HYDROCHLORIDE may also find use in analytical chemistry as a reference material or standard for the development and validation of analytical methods, particularly those involving the analysis of complex organic molecules.
Used in Biomedical Research:
(S)-4-[2-HYDROXY-3-PHENOXYPROPYLAMINOETHOXY]PHENOXYACETIC ACID HYDROCHLORIDE could be employed in biomedical research to investigate its interactions with biological systems, such as proteins, enzymes, or cell receptors, which may lead to a better understanding of its potential therapeutic applications.
Biological Activity
The active metabolite of ZD 7114 ((S)-4-[2-Hydroxy-3-phenoxypropylaminoethoxy]-N-(2-methoxyethyl)phenoxyacetamide hydrochloride ).
Check Digit Verification of cas no
The CAS Registry Mumber 141269-99-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,1,2,6 and 9 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 141269-99:
(8*1)+(7*4)+(6*1)+(5*2)+(4*6)+(3*9)+(2*9)+(1*9)=130
130 % 10 = 0
So 141269-99-0 is a valid CAS Registry Number.
InChI:InChI=1/C19H23NO6.ClH/c21-15(13-25-16-4-2-1-3-5-16)12-20-10-11-24-17-6-8-18(9-7-17)26-14-19(22)23;/h1-9,15,20-21H,10-14H2,(H,22,23);1H/t15-;/m1./s1