14129-84-1 Usage
Uses
Used in Pharmaceutical Industry:
2-(DICHLOROMETHYL)-3,3-DICHLOROPROPENAL is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its reactivity allows for the creation of a range of medicinal compounds, contributing to the development of new treatments and therapies.
Used in Agrochemical Industry:
Similarly, in the agrochemical sector, 2-(DICHLOROMETHYL)-3,3-DICHLOROPROPENAL serves as an intermediate in the production of different agrochemicals. It plays a role in the formulation of substances that help protect crops and enhance agricultural productivity.
Given the compound's hazardous nature, it is crucial to implement strict safety measures during its use in both the pharmaceutical and agrochemical industries to minimize exposure risks and environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 14129-84-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,1,2 and 9 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 14129-84:
(7*1)+(6*4)+(5*1)+(4*2)+(3*9)+(2*8)+(1*4)=91
91 % 10 = 1
So 14129-84-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H2Cl4O/c5-3(6)2(1-9)4(7)8/h1,3H
