14160-39-5 Usage
General Description
2-[3-(3-Methoxyphenyl)allylidene]malonic acid is a chemical compound with the molecular formula C13H12O5. It is a malonic acid derivative and contains an allylidene substituent and a 3-methoxyphenyl group. 2-[3-(3-METHOXYPHENYL)ALLYLIDENE]MALONIC ACID has potential applications in the pharmaceutical industry, as it exhibits anti-inflammatory and antioxidant properties. Additionally, its allylidene group gives it the potential to act as a Michael acceptor in organic reactions. The presence of the malonic acid moiety also confers potential for use in organic synthesis and as a building block for the preparation of more complex molecules. Overall, 2-[3-(3-Methoxyphenyl)allylidene]malonic acid has versatility in both industrial and research applications due to its unique chemical structure and potential biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 14160-39-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,1,6 and 0 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 14160-39:
(7*1)+(6*4)+(5*1)+(4*6)+(3*0)+(2*3)+(1*9)=75
75 % 10 = 5
So 14160-39-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H12O5/c1-18-10-6-2-4-9(8-10)5-3-7-11(12(14)15)13(16)17/h2-8H,1H3,(H,14,15)(H,16,17)/b5-3-
