14160-39-5 Usage
Uses
Used in Pharmaceutical Industry:
2-[3-(3-Methoxyphenyl)allylidene]malonic acid is used as a pharmaceutical compound for its anti-inflammatory and antioxidant properties. Its ability to modulate inflammatory responses and combat oxidative stress makes it a promising candidate for the development of new therapeutic agents.
Used in Organic Synthesis:
In the field of organic chemistry, 2-[3-(3-Methoxyphenyl)allylidene]malonic acid is used as a building block and a Michael acceptor in various organic reactions. Its allylidene group allows for the formation of new carbon-carbon bonds, facilitating the synthesis of more complex organic molecules.
Used in Research Applications:
2-[3-(3-Methoxyphenyl)allylidene]malonic acid is utilized in research settings to explore its potential biological activities and to study the effects of its unique chemical structure on various biological processes. This includes investigating its role in anti-inflammatory and antioxidant mechanisms, as well as its potential use in the development of new pharmaceutical agents.
Overall, 2-[3-(3-Methoxyphenyl)allylidene]malonic acid's diverse applications across different industries highlight its importance in both scientific research and practical applications, making it a valuable compound for further exploration and development.
Check Digit Verification of cas no
The CAS Registry Mumber 14160-39-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,1,6 and 0 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 14160-39:
(7*1)+(6*4)+(5*1)+(4*6)+(3*0)+(2*3)+(1*9)=75
75 % 10 = 5
So 14160-39-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H12O5/c1-18-10-6-2-4-9(8-10)5-3-7-11(12(14)15)13(16)17/h2-8H,1H3,(H,14,15)(H,16,17)/b5-3-
