14174-83-5 Usage
Uses
Used in Polymer Production:
Hexahydro-pyrrolizin-1-one is used as a key component in the production of polymers due to its ability to enhance the properties of these materials, such as their stability and durability.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, Hexahydro-pyrrolizin-1-one is utilized as a solvent and a chemical intermediate, playing a crucial role in the synthesis of various medicinal compounds.
Used in Agrochemicals:
HEXAHYDRO-PYRROLIZIN-1-ONE is also employed in the agrochemical industry, where it contributes to the formulation of products designed to protect and enhance crop yields.
Used as a Solvent:
Hexahydro-pyrrolizin-1-one is used as a solvent in various chemical processes, capitalizing on its high boiling point and solubility to facilitate reactions and dissolve substances effectively.
Used in Chemical Synthesis:
As a chemical intermediate, Hexahydro-pyrrolizin-1-one is integral to the synthesis of other organic compounds, enabling the creation of a wide array of products across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 14174-83-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,1,7 and 4 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14174-83:
(7*1)+(6*4)+(5*1)+(4*7)+(3*4)+(2*8)+(1*3)=95
95 % 10 = 5
So 14174-83-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO/c9-7-3-5-8-4-1-2-6(7)8/h6H,1-5H2
