141764-88-7 Usage
Description
4-CHLORO-2-(1-METHYL-4-PIPERAZINYL)-5-THIAZOLECARBOXALDEHYDE is a chemical compound characterized by the presence of a chloro group, a methyl group, a piperazinyl group, and a thiazolecarboxaldehyde group. It serves as a versatile intermediate in the synthesis of pharmaceuticals and agrochemicals, and is recognized for its potential in the pharmaceutical industry as a building block for the creation of various organic molecules.
Uses
Used in Pharmaceutical Industry:
4-CHLORO-2-(1-METHYL-4-PIPERAZINYL)-5-THIAZOLECARBOXALDEHYDE is used as a chemical intermediate for the synthesis of diverse organic molecules, contributing to the development of new pharmaceuticals. Its unique structure allows for the creation of compounds with potential therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical sector, 4-CHLORO-2-(1-METHYL-4-PIPERAZINYL)-5-THIAZOLECARBOXALDEHYDE is utilized as a precursor in the production of various agrochemicals, including pesticides and herbicides, due to its ability to form stable and effective compounds.
Safety Considerations:
It is crucial to handle 4-CHLORO-2-(1-METHYL-4-PIPERAZINYL)-5-THIAZOLECARBOXALDEHYDE with care and adhere to proper safety protocols to mitigate potential health risks associated with its use.
Check Digit Verification of cas no
The CAS Registry Mumber 141764-88-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,1,7,6 and 4 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 141764-88:
(8*1)+(7*4)+(6*1)+(5*7)+(4*6)+(3*4)+(2*8)+(1*8)=137
137 % 10 = 7
So 141764-88-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H12ClN3OS/c1-12-2-4-13(5-3-12)9-11-8(10)7(6-14)15-9/h6H,2-5H2,1H3