141831-72-3 Usage
Description
3-bromo-5-isopropyl-1H-1,2,4-triazole is a chemical compound with the molecular formula C6H9BrN3. It is a selective herbicide known for its high efficiency and low toxicity to non-target organisms, making it a popular choice for weed control in various crops.
Uses
Used in Agriculture:
3-bromo-5-isopropyl-1H-1,2,4-triazole is used as a selective herbicide for controlling a wide range of annual grasses, broad-leaved weeds, and sedges. Its application reason is its ability to inhibit the enzyme acetolactate synthase, which is crucial for the biosynthesis of branched-chain amino acids in plants, leading to the inhibition of growth and eventual death of the weeds.
The herbicide is typically applied as a foliar spray and is rapidly absorbed by the plant, ensuring effective weed control. Its relatively short half-life and easy breakdown in the environment minimize its potential impact on non-target organisms, supporting crop health and yield in modern agricultural practices.
Check Digit Verification of cas no
The CAS Registry Mumber 141831-72-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,1,8,3 and 1 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 141831-72:
(8*1)+(7*4)+(6*1)+(5*8)+(4*3)+(3*1)+(2*7)+(1*2)=113
113 % 10 = 3
So 141831-72-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H8BrN3/c1-3(2)4-7-5(6)9-8-4/h3H,1-2H3,(H,7,8,9)