141831-73-4 Usage
General Description
1H-1,2,4-Triazole, 3-bromo-5-(2-methylpropyl)- is a chemical compound with the molecular formula C7H11BrN2. It is a derivative of the triazole family, which is known for its diverse biological activities. The compound is commonly used in the synthesis of pharmaceuticals and agrochemicals, as well as in the development of materials and heterocyclic compounds. Its unique structure and properties make it a valuable building block for the creation of new compounds with potential therapeutic and industrial applications. Additionally, 1H-1,2,4-Triazole, 3-bromo-5-(2-methylpropyl)- is also utilized as a research tool in the field of organic chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 141831-73-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,1,8,3 and 1 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 141831-73:
(8*1)+(7*4)+(6*1)+(5*8)+(4*3)+(3*1)+(2*7)+(1*3)=114
114 % 10 = 4
So 141831-73-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H10BrN3/c1-4(2)3-5-8-6(7)10-9-5/h4H,3H2,1-2H3,(H,8,9,10)