141839-02-3 Usage
General Description
1,6-Bis(3,4-dihydroxy-2-benzylpyrrolidine)hexane is a chemical compound with a long, complex name and molecular structure. It is a hexane derivative containing two 3,4-dihydroxy-2-benzylpyrrolidine moieties attached to the hexane backbone. 1,6-Bis(3,4-dihydroxy-2-benzylpyrrolidine)hexane falls into the category of polyhydroxy compounds, meaning it contains multiple hydroxyl (OH) functional groups. The presence of these hydroxyl groups gives the compound antioxidant and chelating properties, making it potentially useful in various applications such as pharmaceuticals, industrial processes, and the production of polymers and plastics. The compound's specific chemical structure and properties make it an interesting subject for further research and potential development of new applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 141839-02-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,1,8,3 and 9 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 141839-02:
(8*1)+(7*4)+(6*1)+(5*8)+(4*3)+(3*9)+(2*0)+(1*2)=123
123 % 10 = 3
So 141839-02-3 is a valid CAS Registry Number.
InChI:InChI=1/C28H40N2O4.2ClH/c31-25-19-29(23(27(25)33)17-21-11-5-3-6-12-21)15-9-1-2-10-16-30-20-26(32)28(34)24(30)18-22-13-7-4-8-14-22;;/h3-8,11-14,23-28,31-34H,1-2,9-10,15-20H2;2*1H