141848-60-4 Usage
Uses
Used in Organic Chemistry:
6-(Bromomethyl)-2-methylquinoline is used as a reagent in various chemical reactions for its ability to facilitate the synthesis of more complex substances. Its unique structure allows it to participate in a range of organic transformations, making it a valuable compound in the field of organic chemistry.
Used in Pharmaceutical Industry:
6-(Bromomethyl)-2-methylquinoline is used as a building block in the development of new pharmaceutical compounds. Its quinoline structure is a common feature in many drugs, and the presence of the bromomethyl and methyl groups can provide additional functional groups for further chemical modifications, potentially leading to the creation of novel therapeutic agents.
Used in Material Science:
6-(Bromomethyl)-2-methylquinoline is used as a precursor in the synthesis of advanced materials, such as organic semiconductors or catalysts. Its reactivity and structural features can be exploited to create new materials with unique properties, contributing to the advancement of material science.
Used in Research and Development:
6-(Bromomethyl)-2-methylquinoline is used as a research compound in academic and industrial laboratories. Its potential reactivity and the possibility of forming new chemical entities make it an interesting subject for exploration in various research projects, including the development of new synthetic methods or the study of its interactions with other compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 141848-60-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,1,8,4 and 8 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 141848-60:
(8*1)+(7*4)+(6*1)+(5*8)+(4*4)+(3*8)+(2*6)+(1*0)=134
134 % 10 = 4
So 141848-60-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H10BrN/c1-8-2-4-10-6-9(7-12)3-5-11(10)13-8/h2-6H,7H2,1H3
