141848-60-4 Usage
General Description
6-(Bromomethyl)-2-methylquinoline is a synthetic, organic compound known for its role in the field of organic chemistry. It is considered as a significant compound because it is often utilized in the production of more complex substances or as a reagent in various chemical reactions. The compound contains a quinoline structure, which is a heterocyclic aromatic organic compound, and it includes a bromomethyl and a methyl group attached to the 6 and 2 positions of the quinoline ring respectively. Although it is not widely analyzed, careful handling is always recommended given its potential reactivity due to the presence of the bromomethyl group. The specific impact on human health or environment from exposure to this chemical is not well understood and therefore additional studies would be required.
Check Digit Verification of cas no
The CAS Registry Mumber 141848-60-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,1,8,4 and 8 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 141848-60:
(8*1)+(7*4)+(6*1)+(5*8)+(4*4)+(3*8)+(2*6)+(1*0)=134
134 % 10 = 4
So 141848-60-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H10BrN/c1-8-2-4-10-6-9(7-12)3-5-11(10)13-8/h2-6H,7H2,1H3
