142137-18-6 Usage
Uses
Used in Pharmaceutical Industry:
3-BROMO-5-(METHYLTHIO)PYRIDINE is used as a building block for the synthesis of pharmaceuticals, contributing to the development of active ingredients and intermediates. Its unique structure allows for the creation of complex molecules with specific functional groups, enhancing the therapeutic potential of new drug candidates.
Used in Agrochemical Industry:
In the agrochemical sector, 3-BROMO-5-(METHYLTHIO)PYRIDINE is utilized as a key intermediate in the synthesis of various agrochemicals. Its presence in the molecular structure of these compounds aids in the development of effective pesticides and other agricultural products.
Used in Materials Science:
3-BROMO-5-(METHYLTHIO)PYRIDINE also has potential applications in the field of materials science, where its unique properties can be leveraged to create novel materials with specific characteristics for various applications.
Used as a Reagent in Organic Chemistry Reactions:
Furthermore, 3-BROMO-5-(METHYLTHIO)PYRIDINE serves as a reagent in organic chemistry, facilitating various chemical reactions and transformations. Its versatile reactivity makes it a valuable tool for chemists in the synthesis of a wide range of organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 142137-18-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,2,1,3 and 7 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 142137-18:
(8*1)+(7*4)+(6*2)+(5*1)+(4*3)+(3*7)+(2*1)+(1*8)=96
96 % 10 = 6
So 142137-18-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H6BrNS/c1-9-6-2-5(7)3-8-4-6/h2-4H,1H3
