14225-83-3 Usage
Benzimidazole derivative
A benzimidazole derivative is a compound that is derived from benzimidazole, which is a heterocyclic aromatic organic compound. 2-(2-Bromo-phenyl)-5-chloro-1H-benzimidazole is a benzimidazole derivative due to its chemical structure.
Bromo-phenyl group
A bromo-phenyl group is a phenyl ring (a six-carbon aromatic ring with three hydrogen atoms) that has a bromine atom attached to it. 2-(2-Bromo-phenyl)-5-chloro-1H-benzimidazole contains a bromo-phenyl group, which contributes to its potential biological activity.
Chlorine atom
2-(2-Bromo-phenyl)-5-chloro-1H-benzimidazole contains a chlorine atom, which is a common halogen that can influence the compound's reactivity and properties.
Medicinal chemistry and pharmaceutical research
2-(2-Bromo-phenyl)-5-chloro-1H-benzimidazole is commonly used in medicinal chemistry and pharmaceutical research due to its potential biological activity.
Antibacterial, antifungal, and antitumor properties
Benzimidazole derivatives, including 2-(2-Bromo-phenyl)-5-chloro-1H-benzimidazole, have been studied for their potential antibacterial, antifungal, and antitumor properties, making them promising candidates for therapeutic applications.
Chemical structure and reactivity
The chemical structure and reactivity of 2-(2-Bromo-phenyl)-5-chloro-1H-benzimidazole make it a promising candidate for further research into its potential therapeutic applications. The presence of the bromo-phenyl group and chlorine atom may contribute to its reactivity and potential biological activity.
Check Digit Verification of cas no
The CAS Registry Mumber 14225-83-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,2,2 and 5 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14225-83:
(7*1)+(6*4)+(5*2)+(4*2)+(3*5)+(2*8)+(1*3)=83
83 % 10 = 3
So 14225-83-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H8BrClN2/c14-10-4-2-1-3-9(10)13-16-11-6-5-8(15)7-12(11)17-13/h1-7H,(H,16,17)
