142450-00-8 Usage
General Description
(E)-4-hydroxyoctadec-2-enal is a chemical compound known for its potential use in various applications. It is a long-chain aldehyde with a hydroxyl group and a double bond, making it a valuable intermediate in the synthesis of various compounds. It is known for its role in flavor and fragrance formulations, as well as in the development of pharmaceuticals and other bioactive molecules. Its unique structure and properties make it a versatile compound for a wide range of potential uses, making it an area of interest for researchers and industries alike.
Check Digit Verification of cas no
The CAS Registry Mumber 142450-00-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,2,4,5 and 0 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 142450-00:
(8*1)+(7*4)+(6*2)+(5*4)+(4*5)+(3*0)+(2*0)+(1*0)=88
88 % 10 = 8
So 142450-00-8 is a valid CAS Registry Number.
InChI:InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18(20)16-14-17-19/h14,16-18,20H,2-13,15H2,1H3/b16-14+