142739-82-0 Usage
General Description
N-Myristoyl-L-serine sodium salt is a chemical compound that consists of a myristoyl fatty acid molecule attached to the amino acid serine, forming a sodium salt. N-Myristoyl-L-serine sodium salt is a derivative of the naturally occurring fatty acid myristic acid and the amino acid serine. It is often used in research and pharmaceutical applications as a cell-penetrating peptide, allowing it to deliver other molecules into cells for various experimental and therapeutic purposes. Additionally, N-Myristoyl-L-serine sodium salt can also interact with proteins and cell membranes, potentially affecting intracellular signaling and other cellular processes.
Check Digit Verification of cas no
The CAS Registry Mumber 142739-82-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,2,7,3 and 9 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 142739-82:
(8*1)+(7*4)+(6*2)+(5*7)+(4*3)+(3*9)+(2*8)+(1*2)=140
140 % 10 = 0
So 142739-82-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H33NO4.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(20)18-15(14-19)17(21)22;/h15,19H,2-14H2,1H3,(H,18,20)(H,21,22);/q;+1/p-1/t15-;/m0./s1
