142810-49-9 Usage
Uses
Used in Pharmaceutical Industry:
Cyclohexanecarboxamide, N-(4-chlorophenyl)is utilized as an intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and functional groups make it a valuable building block for developing new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
Cyclohexanecarboxamide,N-(4-chlorophenyl)serves as a key intermediate in the production of agrochemicals, specifically herbicides and insecticides. Its chemical properties allow for the development of effective formulations that target specific pests or weeds, enhancing crop protection and yield.
Used in Chemical Research:
Cyclohexanecarboxamide, N-(4-chlorophenyl)is employed as a research compound in various scientific studies. Its reactivity and structural features make it an interesting subject for exploring new chemical reactions, synthesis methods, and potential applications in material science or other fields.
Used in Dye and Pigment Industry:
As a chemical intermediate, Cyclohexanecarboxamide,N-(4-chlorophenyl)- contributes to the development of dyes and pigments with specific color properties and stability. Its incorporation into dye molecules can enhance colorfastness, lightfastness, and resistance to various environmental factors.
Used in Polymer Industry:
Cyclohexanecarboxamide, N-(4-chlorophenyl)is used in the synthesis of specialty polymers with unique properties, such as improved mechanical strength, thermal stability, or chemical resistance. These polymers find applications in various industries, including automotive, aerospace, and electronics.
Check Digit Verification of cas no
The CAS Registry Mumber 142810-49-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,2,8,1 and 0 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 142810-49:
(8*1)+(7*4)+(6*2)+(5*8)+(4*1)+(3*0)+(2*4)+(1*9)=109
109 % 10 = 9
So 142810-49-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H16ClNO/c14-11-6-8-12(9-7-11)15-13(16)10-4-2-1-3-5-10/h6-10H,1-5H2,(H,15,16)
