142826-45-7 Usage
General Description
(2,7-Octadien-1-yl)succinic anhydride is a chemical compound that is widely used in the field of chemistry and polymer science. It is a reactive compound that is often employed in the modification of polymers and resins to improve their properties. The presence of the octadienyl group in the molecule gives it the ability to participate in various chemical reactions, making it a versatile compound for functionalization of polymers. This chemical is also used in the production of adhesives, coatings, and other industrial applications. Overall, (2,7-Octadien-1-yl)succinic anhydride plays a crucial role in the development of advanced materials for various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 142826-45-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,2,8,2 and 6 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 142826-45:
(8*1)+(7*4)+(6*2)+(5*8)+(4*2)+(3*6)+(2*4)+(1*5)=127
127 % 10 = 7
So 142826-45-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H16O3/c1-2-3-4-5-6-7-8-10-9-11(13)15-12(10)14/h2,6-7,10H,1,3-5,8-9H2/b7-6+
