14315-13-0 Usage
Type of compound
Heterocyclic compound
Structure
Contains a benzene ring fused to a thiophene ring
Usage
Commonly used in organic synthesis and medicinal chemistry as a building block for the production of various pharmaceuticals and agrochemicals
Potential
Studied for its potential biological activities and of interest in drug discovery research
Unique features
Unique chemical structure and properties that may have potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 14315-13-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,3,1 and 5 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14315-13:
(7*1)+(6*4)+(5*3)+(4*1)+(3*5)+(2*1)+(1*3)=70
70 % 10 = 0
So 14315-13-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H8O2S/c9-11(10)6-5-7-3-1-2-4-8(7)11/h1-4H,5-6H2
