143185-79-9 Usage
Explanation
Different sources of media describe the Explanation of 143185-79-9 differently. You can refer to the following data:
1. The compound's name describes its structure, which includes a butyl and propenyl group attached to a benzo[cd]indol-2(1H)-ylidene moiety.
2. The compound has a complex molecular structure due to the presence of multiple functional groups and a large number of atoms.
3. The compound consists of a benzo[cd]indolium cation and a tetrafluoroborate anion, making it an ionic compound.
4. The cation is a positively charged ion derived from the benzo[cd]indol molecule.
5. The anion is a negatively charged ion with four fluorine atoms attached to a boron atom.
6. The compound contains a butyl group (a four-carbon chain), a propenyl group (a three-carbon chain with a double bond), and a benzo[cd]indol-2(1H)-ylidene moiety (a fused indole and benzene ring system).
7. As an ionic liquid, it exists in a liquid state at room temperature due to the strong electrostatic interactions between the cations and anions.
8. Due to its ionic nature, the compound is expected to be soluble in polar solvents such as water and alcohols.
9. As an ionic compound, it is generally stable under normal conditions, such as room temperature and pressure. However, it may react with strong acids, bases, or reducing agents.
Molecular Structure
Complex
Ionic Compound
Yes
Cation
Benzo[cd]indolium
Anion
Tetrafluoroborate
Functional Groups
Butyl, Propenyl, Benzo[cd]indol-2(1H)-ylidene
Physical State
Liquid (Ionic liquid)
Applications
Organic synthesis, catalysis
Solubility
Soluble in polar solvents
Stability
Stable under normal conditions
Check Digit Verification of cas no
The CAS Registry Mumber 143185-79-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,3,1,8 and 5 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 143185-79:
(8*1)+(7*4)+(6*3)+(5*1)+(4*8)+(3*5)+(2*7)+(1*9)=129
129 % 10 = 9
So 143185-79-9 is a valid CAS Registry Number.
InChI:InChI=1/C33H33N2.BF4/c1-3-5-22-34-28(26-16-7-12-24-14-9-20-30(34)32(24)26)18-11-19-29-27-17-8-13-25-15-10-21-31(33(25)27)35(29)23-6-4-2;2-1(3,4)5/h7-21H,3-6,22-23H2,1-2H3;/q+1;-1