1432-14-0 Usage
Uses
Used in Agricultural and Horticultural Industries:
Bis(2-hydroxyethyl)ammonium 2-(4-chloro-2-methylphenoxy)propionate is used as a herbicide for controlling broadleaf weeds in various crops. It is effective due to its ability to disrupt the growth and development of targeted weeds, ultimately leading to their death. This selective action is crucial for maintaining crop health and productivity while minimizing the impact on non-target plant species.
The use of bis(2-hydroxyethyl)ammonium 2-(4-chloro-2-methylphenoxy)propionate in herbicidal applications is significant for several reasons:
1. It targets specific weeds, reducing the need for more broad-spectrum and potentially harmful chemicals.
2. It can be part of an integrated pest management strategy, which combines different methods to control pests and weeds more effectively and sustainably.
3. Its application can lead to improved crop yields by reducing competition from weeds, thus allowing crops to access more resources for growth.
However, due to its potent herbicidal properties, it is imperative to handle and apply bis(2-hydroxyethyl)ammonium 2-(4-chloro-2-methylphenoxy)propionate with care, adhering to safety protocols to protect both human health and the environment. Proper use includes measures such as avoiding drift to non-target areas, using appropriate personal protective equipment, and following label instructions for application rates and timing.
Check Digit Verification of cas no
The CAS Registry Mumber 1432-14-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,4,3 and 2 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1432-14:
(6*1)+(5*4)+(4*3)+(3*2)+(2*1)+(1*4)=50
50 % 10 = 0
So 1432-14-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H11ClO3.C4H11NO2/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;6-3-1-5-2-4-7/h3-5,7H,1-2H3,(H,12,13);5-7H,1-4H2
