143228-86-8 Usage
Uses
Used in Organic Synthesis:
5-Oxohex-2-enoic acid is used as a key intermediate in the synthesis of various organic compounds. Its versatile structure allows for the formation of different functional groups, making it a valuable building block in the development of new molecules with potential applications in various industries.
Used in Pharmaceutical Research:
5-Oxohex-2-enoic acid is used as a starting material in the development of new drugs for various diseases. Its potential medicinal properties, such as antioxidant and anti-inflammatory effects, make it a promising candidate for the treatment of conditions like inflammation, oxidative stress, and other related disorders.
Used in Antioxidant Applications:
5-Oxohex-2-enoic acid is used as an antioxidant agent for its ability to neutralize free radicals and protect cells from oxidative damage. Its antioxidant properties can be beneficial in the prevention and treatment of various diseases associated with oxidative stress, such as cardiovascular diseases, neurodegenerative disorders, and cancer.
Used in Anti-inflammatory Applications:
5-Oxohex-2-enoic acid is used as an anti-inflammatory agent for its potential to reduce inflammation and alleviate symptoms associated with inflammatory conditions. Its anti-inflammatory effects can be useful in the management of chronic inflammatory diseases, such as arthritis, asthma, and inflammatory bowel disease.
Used in Drug Development:
5-Oxohex-2-enoic acid is used as a lead compound in the development of new drugs for various diseases. Its unique structure and potential medicinal properties make it an attractive candidate for further research and optimization to improve its therapeutic efficacy and safety profile.
Check Digit Verification of cas no
The CAS Registry Mumber 143228-86-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,3,2,2 and 8 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 143228-86:
(8*1)+(7*4)+(6*3)+(5*2)+(4*2)+(3*8)+(2*8)+(1*6)=118
118 % 10 = 8
So 143228-86-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H8O3/c1-5(7)3-2-4-6(8)9/h2,4H,3H2,1H3,(H,8,9)
