14328-62-2 Usage
Uses
Used in Pharmaceutical Industry:
L-Cyclopentyl-gly-methyl ester HCL is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Chemical Research:
L-Cyclopentyl-gly-methyl ester HCL is used as a research compound in the field of organic chemistry. Its distinct functional groups make it a valuable tool for studying reaction mechanisms, exploring new synthetic routes, and understanding the properties of cycloalkanes and amino acid derivatives.
Used in Drug Delivery Systems:
L-Cyclopentyl-gly-methyl ester HCL is used as a component in the design of drug delivery systems. Its chemical properties can be exploited to improve the solubility, stability, and bioavailability of therapeutic agents, potentially enhancing their efficacy and reducing side effects.
Used in Biochemical Studies:
L-Cyclopentyl-gly-methyl ester HCL is used as a model compound in biochemical research. Its structure can provide insights into the interactions between amino acids, cycloalkanes, and other biomolecules, contributing to a better understanding of biological processes and the development of novel therapeutic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 14328-62-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,3,2 and 8 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 14328-62:
(7*1)+(6*4)+(5*3)+(4*2)+(3*8)+(2*6)+(1*2)=92
92 % 10 = 2
So 14328-62-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H15NO2.ClH/c1-11-8(10)7(9)6-4-2-3-5-6;/h6-7H,2-5,9H2,1H3;1H/t7-;/m0./s1
