143317-76-4 Usage
General Description
1,5-bis(3,4-dimethoxyphenyl)tetrahydropyran is a chemical compound with the molecular formula C22H26O4. It is a tetrahydropyran derivative that contains two 3,4-dimethoxyphenyl groups. 1,5-bis(3,4-dimethoxyphenyl)tetrahydropyran is often used in the field of organic chemistry as a building block for the synthesis of various pharmaceuticals, agrochemicals, and other fine chemicals. It is known for its ability to form stable and rigid structures, making it useful in the development of drugs and other bioactive compounds. Additionally, 1,5-bis(3,4-dimethoxyphenyl)tetrahydropyran is also used as a flavoring agent in food and beverage industries.
Check Digit Verification of cas no
The CAS Registry Mumber 143317-76-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,3,3,1 and 7 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 143317-76:
(8*1)+(7*4)+(6*3)+(5*3)+(4*1)+(3*7)+(2*7)+(1*6)=114
114 % 10 = 4
So 143317-76-4 is a valid CAS Registry Number.
InChI:InChI=1/C21H26O5/c1-22-18-10-8-14(12-20(18)24-3)16-6-5-7-17(26-16)15-9-11-19(23-2)21(13-15)25-4/h8-13,16-17H,5-7H2,1-4H3