144040-48-2 Usage
Description
2,5-dihydro-2,5-dioxo-3-hydroxy-8-methyl-1H-benzazepine is a chemical compound with the molecular formula C14H13NO4. It belongs to the benzazepine class of organic compounds and is derived from the benzazepine skeleton. 2,5-dihydro-2,5-dioxo-3-hydroxy-8-methyl-1H-benzazepine contains a benzene ring fused to a seven-membered azepine ring, along with various functional groups such as hydroxyl and carbonyl groups. It is a synthetic chemical and is not commonly found in nature. 2,5-dihydro-2,5-dioxo-3-hydroxy-8-methyl-1H-benzazepine has potential pharmaceutical applications and may be used as a precursor or intermediate in the synthesis of other organic compounds. Its specific properties, uses, and effects may vary depending on its specific application and formulation.
Uses
Used in Pharmaceutical Industry:
2,5-dihydro-2,5-dioxo-3-hydroxy-8-methyl-1H-benzazepine is used as a potential pharmaceutical compound for its potential therapeutic effects. Its unique structure and functional groups may contribute to its activity in various biological systems, making it a candidate for further research and development in drug discovery.
Used in Organic Synthesis:
2,5-dihydro-2,5-dioxo-3-hydroxy-8-methyl-1H-benzazepine is used as a precursor or intermediate in the synthesis of other organic compounds. Its structural features and reactivity may be exploited in the preparation of more complex molecules, which could have applications in various fields such as medicine, materials science, or agrochemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 144040-48-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,4,0,4 and 0 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 144040-48:
(8*1)+(7*4)+(6*4)+(5*0)+(4*4)+(3*0)+(2*4)+(1*8)=92
92 % 10 = 2
So 144040-48-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO3/c1-6-2-3-7-8(4-6)12-11(15)10(14)5-9(7)13/h2-5,13H,1H3,(H,12,14,15)
