14436-34-1 Usage
General Description
2,4(3H,5H)-Pyrimidinedione, 6-amino- (9CI), also known as adenine, is a chemical compound found in the nucleic acids of DNA and RNA. It is a purine base that plays a crucial role in the structure and function of genetic material. Adenine is involved in the pairing of nucleotides and the formation of hydrogen bonds, which are essential for the stability and integrity of the genetic code. It also serves as a precursor to other important molecules, such as adenosine triphosphate (ATP), which is a primary source of energy for cellular processes. Adenine is a vital component of the genetic code and crucial for the proper functioning of living organisms.
Check Digit Verification of cas no
The CAS Registry Mumber 14436-34-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,4,3 and 6 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 14436-34:
(7*1)+(6*4)+(5*4)+(4*3)+(3*6)+(2*3)+(1*4)=91
91 % 10 = 1
So 14436-34-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H5N3O2/c5-2-1-3(8)7-4(9)6-2/h1H2,(H3,5,6,7,8,9)