144401-04-7 Usage
Molecular structure
The compound has a complex molecular structure with two subunits derived from a bicyclic compound linked by an ethane-1,2-dione bridge.
Subunits
The two subunits are 3-methyl-5-oxo-2,6-diazabicyclo[5.4.0]undeca-7,9,11-trien-2-yl.
Bicyclic compound
The subunits are derived from a bicyclic compound, which is a type of cyclic compound with two rings.
Ethane-1,2-dione bridge
The two subunits are linked by an ethane-1,2-dione bridge, which is a type of chemical structure that connects two parts of a molecule.
Functional groups
The compound contains multiple functional groups, including ketones, which play important roles in chemical reactivity.
Chemical reactivity
The presence of functional groups, such as ketones, suggests that the compound may have potential for various chemical applications.
Potential applications
The compound may have potential applications in fields such as organic synthesis, pharmaceuticals, or materials science.
Synthesis and purification challenges
The complex structure and functional groups of the compound may pose challenges for its synthesis and purification.
Check Digit Verification of cas no
The CAS Registry Mumber 144401-04-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,4,4,0 and 1 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 144401-04:
(8*1)+(7*4)+(6*4)+(5*4)+(4*0)+(3*1)+(2*0)+(1*4)=87
87 % 10 = 7
So 144401-04-7 is a valid CAS Registry Number.
InChI:InChI=1/C22H22N4O4/c1-13-11-19(27)23-15-7-3-5-9-17(15)25(13)21(29)22(30)26-14(2)12-20(28)24-16-8-4-6-10-18(16)26/h3-10,13-14H,11-12H2,1-2H3,(H,23,27)(H,24,28)