14451-99-1 Usage
Uses
Used in Pharmaceutical Industry:
4,6-dimethylpyrimidin-2-ol--1,2,3,4-tetrahydro-2-methyl-1,4-dioxonaphthalene-2-sulphonic acid (1:1) is used as an active pharmaceutical ingredient for the development of new drugs. Its unique chemical structure allows for potential interactions with biological targets, making it a candidate for the treatment of various diseases and conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 4,6-dimethylpyrimidin-2-ol--1,2,3,4-tetrahydro-2-methyl-1,4-dioxonaphthalene-2-sulphonic acid (1:1) is used as a key component in the formulation of pesticides and herbicides. Its chemical properties may contribute to the effectiveness of these products in controlling pests and weeds, thereby enhancing crop protection.
Used in Industrial Applications:
4,6-dimethylpyrimidin-2-ol--1,2,3,4-tetrahydro-2-methyl-1,4-dioxonaphthalene-2-sulphonic acid (1:1) is employed as a specialty chemical in various industrial processes. Its versatility and reactivity make it suitable for use in the synthesis of other compounds, potentially leading to advancements in materials science and chemical engineering.
Check Digit Verification of cas no
The CAS Registry Mumber 14451-99-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,4,5 and 1 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 14451-99:
(7*1)+(6*4)+(5*4)+(4*5)+(3*1)+(2*9)+(1*9)=101
101 % 10 = 1
So 14451-99-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H3
