145129-54-0 Usage
Description
METHYL 2,5-DICHLOROTHIOPHENE-3-CARBOXYLATE is an organic compound with the chemical formula C6H3Cl2O2S. It is characterized by its thiophene ring structure with two chlorine atoms and a carboxylate group attached to it. METHYL 2,5-DICHLOROTHIOPHENE-3-CARBOXYLATE is known for its reactivity and is commonly used as a reagent in various chemical processes.
Uses
Used in Electrochemical Polymerization:
METHYL 2,5-DICHLOROTHIOPHENE-3-CARBOXYLATE is used as a key reagent in the electrochemical polymerization of pyrrole with water-soluble polymeric electrolyte. Its role in this process is to facilitate the formation of a conductive polymer, which has potential applications in various fields such as energy storage, sensors, and electronic devices.
Check Digit Verification of cas no
The CAS Registry Mumber 145129-54-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,5,1,2 and 9 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 145129-54:
(8*1)+(7*4)+(6*5)+(5*1)+(4*2)+(3*9)+(2*5)+(1*4)=120
120 % 10 = 0
So 145129-54-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H4Cl2O2S/c1-10-6(9)3-2-4(7)11-5(3)8/h2H,1H3
