145229-76-1 Usage
General Description
The chemical "H-SER-PHE-LEU-LEU-ARG-ASN-PRO-OH" is a peptide consisting of the amino acids serine, phenylalanine, leucine, leucine, arginine, asparagine, and proline. It is a linear chain of these amino acids, with an N-terminal hydrogen atom and a C-terminal hydroxyl group. Peptides play a crucial role in various biological processes, such as cell signaling, enzyme activity, and immune function. The specific sequence of amino acids in this peptide may have implications for its biological activity and potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 145229-76-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,5,2,2 and 9 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 145229-76:
(8*1)+(7*4)+(6*5)+(5*2)+(4*2)+(3*9)+(2*7)+(1*6)=131
131 % 10 = 1
So 145229-76-1 is a valid CAS Registry Number.
InChI:InChI=1/C39H63N11O10/c1-21(2)16-26(47-35(56)27(17-22(3)4)48-36(57)28(46-32(53)24(40)20-51)18-23-10-6-5-7-11-23)34(55)45-25(12-8-14-44-39(42)43)33(54)49-29(19-31(41)52)37(58)50-15-9-13-30(50)38(59)60/h5-7,10-11,21-22,24-30,51H,8-9,12-20,40H2,1-4H3,(H2,41,52)(H,45,55)(H,46,53)(H,47,56)(H,48,57)(H,49,54)(H,59,60)(H4,42,43,44)/t24-,25-,26-,27-,28-,29-,30-/m0/s1