145349-66-2 Usage
Uses
Used in Pharmaceutical Industry:
4-Bromo-2,5-difluoroiodobenzene is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique reactivity allows for the formation of complex organic molecules that are essential in the development of new drugs and therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Bromo-2,5-difluoroiodobenzene serves as a building block for the production of agrochemicals. Its incorporation into these compounds contributes to the development of effective pesticides, herbicides, and other agricultural products.
Used in Dye Industry:
4-Bromo-2,5-difluoroiodobenzene is used as an intermediate in the production of dyes. Its unique properties enable the creation of dyes with specific characteristics, such as color intensity and stability, which are crucial for various applications in textiles, printing, and other industries.
Used in Polymer Industry:
4-BROMO-2,5-DIFLUOROIODOBENZENE is also utilized in the synthesis of polymers. Its reactivity and structural features contribute to the development of polymers with specific properties, such as thermal stability, mechanical strength, and chemical resistance, which are essential for various industrial applications.
Used in Organic Synthesis:
4-Bromo-2,5-difluoroiodobenzene is used as a reagent in organic synthesis, particularly in the preparation of complex organic molecules. Its unique reactivity allows for the formation of a wide range of compounds, making it a versatile building block in the synthesis of various organic compounds.
Safety and Environmental Considerations:
As with any chemical, proper handling and disposal procedures should be followed when working with 4-Bromo-2,5-difluoroiodobenzene to ensure safety and environmental protection. This includes the use of appropriate personal protective equipment, adherence to safety guidelines, and proper disposal of waste materials to minimize potential hazards and environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 145349-66-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,5,3,4 and 9 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 145349-66:
(8*1)+(7*4)+(6*5)+(5*3)+(4*4)+(3*9)+(2*6)+(1*6)=142
142 % 10 = 2
So 145349-66-2 is a valid CAS Registry Number.
InChI:InChI=1S/C6H2BrF2I/c7-3-1-5(9)6(10)2-4(3)8/h1-2H
145349-66-2Relevant academic research and scientific papers
Synthesis, mesomorphic behaviour and optical anisotropy of some novel materials for nematic mixtures of high birefringence
Hird, Michael,Toyne, Kenneth J.,Goodby, John W.,Gray, George W.,Minter, Victoria,Tuffin, Rachel P.,McDonnell, Damien G.
, p. 1731 - 1743 (2007/10/03)
Structural moieties including core units (such as phenyl, naphthyl and thiophenyl), linking groups (such as ethynyl), terminal substituents (such as cyano, isothiocyanato and fluoro), and lateral fluoro substituents have been incorporated into novel mater
Anisotropic organic compounds
-
, (2008/06/13)
STR1 The invention describes liquid crystalline compounds or formula (I), where A, D and G are independently selected from phenyl, thiophene, hydrogenated phenyl, chlorinated phenyl and fluorinated phenyl, B and E are independently selected from a single bond C= C. C C.C00, azoxy and diazo, k and m are independently selected from 1 and 0, such that m+n is 1 or 2, and R1 and R2 are independently selected from R, R0, alkynyl, thioalkyl, hydrogen, CN, NCS and SCN; provided that at least one of R1 and R2 is selected from CN, NCS and SCN and that at least one of A, D and G is phenyl; and excluding where at least one of R1 and R2 is independently selected as CN and one of A, D or G is not thiophene, and where m is 0, A, and D are phenyl, B is a single bond and only one of R1 or R2 is NCS. Also described are compounds suitable for inclusion in a device utilizing pretransitional characteristics of liquid crystalline materials in the isotropic phase, of general formula (II) where J and Y are independently selected from phenyl, thiophene, hydrogenated phenyl, chlorinated phenyl and fluorinated phenyl, X is selected from C= C. C C.COO azoxy and diazo, k is 1 or 0 and R3 and R4 are independently selected from R, RO, alkynyl, thioalkyl, hydrogen, CN, NCS and SCN; provided that at least one of R3 and R4 is selected from CN, NCS and SCN and that at least one of J and Y is phenyl.
