145784-34-5 Usage
Uses
Used in Pharmaceutical Research:
(E)-ETHYL 2-OXO-4-(THIOPHEN-2-YL)BUT-3-ENOATE is used as a key intermediate in the development of new drugs and pharmaceuticals. Its unique chemical structure allows for the creation of novel therapeutic agents, potentially leading to advancements in the treatment of various medical conditions.
Used in Organic Synthesis:
In the field of organic synthesis, (E)-ETHYL 2-OXO-4-(THIOPHEN-2-YL)BUT-3-ENOATE serves as a starting material for the synthesis of other organic compounds. Its versatile chemical properties enable it to be a building block in the creation of a wide range of molecules with diverse applications.
Used in Material Development:
(E)-ETHYL 2-OXO-4-(THIOPHEN-2-YL)BUT-3-ENOATE may also have potential applications in the development of new materials. Its unique chemical properties could contribute to the creation of innovative materials with specific characteristics, such as improved stability or enhanced reactivity.
Safety Precautions:
When working with (E)-ETHYL 2-OXO-4-(THIOPHEN-2-YL)BUT-3-ENOATE, it is crucial to follow proper handling procedures and take necessary precautions. This chemical compound may pose potential health hazards if not used correctly, and therefore, it is essential to minimize exposure and ensure a safe working environment.
Check Digit Verification of cas no
The CAS Registry Mumber 145784-34-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,5,7,8 and 4 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 145784-34:
(8*1)+(7*4)+(6*5)+(5*7)+(4*8)+(3*4)+(2*3)+(1*4)=155
155 % 10 = 5
So 145784-34-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H10O3S/c1-2-13-10(12)9(11)6-5-8-4-3-7-14-8/h3-7H,2H2,1H3/b6-5+
