14580-30-4 Usage
Uses
Used in Pharmaceutical Industry:
4-(2,5-DICHLOROPHENYL)-3-THIOSEMICARBAZIDE is used as a pharmaceutical compound for its potential antibacterial, antifungal, and antitumor properties. Its ability to target and combat various types of infections and tumors makes it a valuable asset in the development of new drugs to treat a range of diseases.
Used in Chemical Synthesis:
In the field of chemical synthesis, 4-(2,5-DICHLOROPHENYL)-3-THIOSEMICARBAZIDE serves as a reagent, contributing to the creation of new chemical entities with potential applications in various industries. Its unique structure allows it to participate in a variety of chemical reactions, facilitating the synthesis of complex molecules.
Used in Medicinal Chemistry Research:
4-(2,5-DICHLOROPHENYL)-3-THIOSEMICARBAZIDE is utilized as a subject of study in medicinal chemistry research. Scientists explore its potential interactions with biological targets, such as enzymes and receptors, to understand its mechanisms of action and optimize its properties for therapeutic use.
Used in Drug Development:
As a promising candidate for drug development, 4-(2,5-DICHLOROPHENYL)-3-THIOSEMICARBAZIDE is employed in the design and testing of new pharmaceutical agents. Its potential to exhibit significant biological activities positions it as a key component in the creation of innovative treatments for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 14580-30-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,5,8 and 0 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 14580-30:
(7*1)+(6*4)+(5*5)+(4*8)+(3*0)+(2*3)+(1*0)=94
94 % 10 = 4
So 14580-30-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H7Cl2N3S/c8-4-1-2-5(9)6(3-4)11-7(13)12-10/h1-3H,10H2,(H2,11,12,13)
