145934-57-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-3-methylpyrrolo[2,3-b]pyridine is used as a key intermediate in the synthesis of various pharmaceutical drugs. Its unique structure and reactivity allow for the creation of a broad range of biologically active molecules, making it a crucial component in drug discovery and development processes.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Chloro-3-methylpyrrolo[2,3-b]pyridine serves as a vital building block for the production of agrochemicals. Its incorporation into these compounds can enhance their effectiveness in pest control and crop protection, contributing to increased agricultural productivity.
Used in Medicinal Chemistry Research:
2-Chloro-3-methylpyrrolo[2,3-b]pyridine is utilized as a starting material in the development of new treatments for cancer. Its potential to interact with specific biological targets makes it a promising candidate for the creation of novel anticancer agents.
Used in Neurological Disorder Treatments:
CMMPy is also explored for its applications in the treatment of neurological disorders. Its ability to modulate various biological pathways and interact with specific receptors positions it as a potential therapeutic agent for conditions affecting the nervous system.
Overall, 2-Chloro-3-methylpyrrolo[2,3-b]pyridine's diverse applications across different industries highlight its significance as a versatile and valuable chemical compound in modern science and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 145934-57-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,5,9,3 and 4 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 145934-57:
(8*1)+(7*4)+(6*5)+(5*9)+(4*3)+(3*4)+(2*5)+(1*7)=152
152 % 10 = 2
So 145934-57-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H7ClN2/c1-5-6-3-2-4-10-8(6)11-7(5)9/h2-4H,1H3,(H,10,11)
145934-57-2Relevant academic research and scientific papers
ACTIVE COMPOUNDS
-
, (2008/06/13)
Therapeutically active compounds of the formula: wherein the variables are defined in the specification are provided
