1461-27-4 Usage
Uses
Used in Fragrance and Flavor Industry:
(R)-1-methyl-5-(1-methylvinyl)cyclohexene is used as a key ingredient in the production of fragrances and flavors due to its unique aromatic properties. Its ability to impart pleasant scents and tastes makes it a valuable component in the creation of various consumer products.
Used in Organic Synthesis:
(R)-1-methyl-5-(1-methylvinyl)cyclohexene serves as a versatile building block in the synthesis of other organic compounds. Its reactive double bond and cyclic structure allow for various chemical reactions, enabling the production of a wide range of molecules with diverse applications.
Used in Pharmaceutical Industry:
(R)-1-methyl-5-(1-methylvinyl)cyclohexene is used as a potential candidate in the development of new medicines. Its biological activity has been studied, and ongoing research aims to harness its properties for therapeutic purposes, potentially leading to the discovery of novel drugs and treatments.
Used in Research and Development:
(R)-1-methyl-5-(1-methylvinyl)cyclohexene is utilized in scientific research and development to explore its properties and potential applications. Its unique structure and reactivity make it an interesting subject for studies in organic chemistry, materials science, and other related fields.
Check Digit Verification of cas no
The CAS Registry Mumber 1461-27-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,4,6 and 1 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1461-27:
(6*1)+(5*4)+(4*6)+(3*1)+(2*2)+(1*7)=64
64 % 10 = 4
So 1461-27-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H16/c1-8(2)10-6-4-5-9(3)7-10/h5,10H,1,4,6-7H2,2-3H3
