146190-75-2 Usage
General Description
Zinc tetrabenzylpyridoporphyrin is a complex chemical compound consisting of a central zinc atom coordinated with four benzyl groups and a pyridine ring within a porphyrin framework. zinc tetrabenzylpyridoporphyrin has unique characteristics due to its symmetrical structure and ability to efficiently bind with various molecules, making it a promising candidate for applications in catalysis, sensing, and biomedical research. Its stable and well-defined structure allows for precise control over its reactivity and properties, making it a versatile tool in chemical and biological studies. Additionally, its interaction with light enables the potential use of zinc tetrabenzylpyridoporphyrin in photodynamic therapy for cancer treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 146190-75-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,6,1,9 and 0 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 146190-75:
(8*1)+(7*4)+(6*6)+(5*1)+(4*9)+(3*0)+(2*7)+(1*5)=132
132 % 10 = 2
So 146190-75-2 is a valid CAS Registry Number.
InChI:InChI=1/C68H52N8.Zn/c1-5-13-49(14-6-1)45-73-37-29-53(30-38-73)65-57-21-23-59(69-57)66(54-31-39-74(40-32-54)46-50-15-7-2-8-16-50)61-25-27-63(71-61)68(56-35-43-76(44-36-56)48-52-19-11-4-12-20-52)64-28-26-62(72-64)67(60-24-22-58(65)70-60)55-33-41-75(42-34-55)47-51-17-9-3-10-18-51;/h1-44H,45-48H2;/q2*+2