1463-67-8 Usage
Uses
Used in Pharmaceutical Industry:
3,5-DIMETHYL-1H-INDOLE-2-CARBALDEHYDE is used as a key building block for the synthesis of various pharmaceuticals due to its versatile chemical structure. It contributes to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 3,5-DIMETHYL-1H-INDOLE-2-CARBALDEHYDE is utilized as a component in the creation of agrochemicals, potentially enhancing crop protection and yield.
Used in Fragrance Industry:
3,5-DIMETHYL-1H-INDOLE-2-CARBALDEHYDE is used as a key ingredient in the production of perfumes and other scented products, capitalizing on its distinctive indole aroma to create unique and appealing fragrances.
Used in Medicinal Chemistry Research:
3,5-DIMETHYL-1H-INDOLE-2-CARBALDEHYDE is employed in medicinal chemistry research for its potential biological activities, such as anti-inflammatory and anticancer properties, making it a subject of interest for the development of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 1463-67-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,4,6 and 3 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1463-67:
(6*1)+(5*4)+(4*6)+(3*3)+(2*6)+(1*7)=78
78 % 10 = 8
So 1463-67-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO/c1-7-3-4-10-9(5-7)8(2)11(6-13)12-10/h3-6,12H,1-2H3
