14661-13-3 Usage
Chemical structure
A triacetate derivative of 1,6-anhydro-beta-D-glucose, which is a modified form of glucose with an anhydro ring and three acetyl groups attached to the hydroxyl groups at positions 2, 3, and 4.
Appearance
White to off-white powder.
Solubility
Soluble in organic solvents such as chloroform, dichloromethane, and acetone.
Pharmaceutical applications
Commonly used as an intermediate in the synthesis of various drugs.
Controlled drug delivery
Studied for its potential use in controlled drug delivery systems due to its ability to form stable inclusion complexes with various drugs.
Precursor for polymer synthesis
Investigated for its potential as a precursor for the synthesis of novel carbohydrate-based polymers.
Field of application
Has various potential applications in the field of pharmaceuticals and materials science.
Safety
As with any chemical compound, it is essential to handle 1,6-anhydro-beta-D-glucose-2,3,4-tri-O-acetate with care and follow proper safety protocols to minimize risks to human health and the environment.
Storage
Should be stored in a cool, dry place, away from light and heat, and in a sealed container to maintain its stability and purity.
Purity
The purity of the compound is crucial for its performance in various applications, and it is typically characterized by techniques such as high-performance liquid chromatography (HPLC) or nuclear magnetic resonance (NMR) spectroscopy.
Check Digit Verification of cas no
The CAS Registry Mumber 14661-13-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,6,6 and 1 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14661-13:
(7*1)+(6*4)+(5*6)+(4*6)+(3*1)+(2*1)+(1*3)=93
93 % 10 = 3
So 14661-13-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H16O8/c1-5(13)17-9-8-4-16-12(20-8)11(19-7(3)15)10(9)18-6(2)14/h8-12H,4H2,1-3H3/t8?,9-,10+,11-,12?/m1/s1
14661-13-3Relevant academic research and scientific papers
1,6-Anhydrofuranoses, XI. - 1,6-Anhydro-α-L-idofuranose
Koell, Peter,John, Hans-Georg,Schulz, Juergen
, p. 613 - 625 (2007/10/02)
The title compound 13 is prepared on different routes from suitable benzyl derivatives with gluco-configuration.Preparations use the susceptibility of axial 5-O-benzyl groups in this compounds to selective hydrogenolysis, thus allowing subsequent inversion of configuration in this position from D-gluco to L-ido by an oxidation/reduction sequence.Only 0.08percent of 13 are found in the equilibrium mixture of idose in acidic medium.It is shown with 4-C-methyltalose as example, that the amount of 1,6-anhydrofuranoses in these equilibria rises significantly by changing the hydroxy groups in 4-position from secondary to tertiary ones.
