146773-33-3 Usage
General Description
7-AMINO-4-(2,5,8-TRIOXANONYL)COUMARIN is a chemical compound that consists of a coumarin core with an appended amino group and a 2,5,8-trioxanon-1-yl side chain. 7-AMINO-4-(2,5,8-TRIOXANONYL)COUMARIN is commonly used as a fluorescent probe for the detection of biological thiols, such as cysteine and glutathione, due to its ability to undergo a specific reaction with thiol groups, leading to a change in its fluorescence properties. Additionally, it has also been utilized for the development of fluorescent chemosensors and bioimaging applications due to its sensitivity and selectivity for thiols, making it a valuable tool for studying thiol-related biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 146773-33-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,6,7,7 and 3 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 146773-33:
(8*1)+(7*4)+(6*6)+(5*7)+(4*7)+(3*3)+(2*3)+(1*3)=153
153 % 10 = 3
So 146773-33-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H19NO5/c1-18-4-5-19-6-7-20-10-11-8-15(17)21-14-9-12(16)2-3-13(11)14/h2-3,8-9H,4-7,10,16H2,1H3
146773-33-3Relevant articles and documents
Hydrosoluble coumarin derivatives, their preparation and their use as an enzyme substrate or for the preparation of such substrates
-
, (2008/06/13)
The invention relates to hydrosoluble coumarin derivatives. These derivatives comply with the formula: STR1 in which R1 represents STR2 with m=1 to 30 and in which R7 can be a hydrogen atom or various groups, R2 to R6 can be different substituents, particularly substituents making it possible to introduce into the derivative an appropriate group as the enzyme substrate or for the synthesis of enzyme substrates.
